I Thought It Meant/M-N: Difference between revisions

Everything About Fiction You Never Wanted to Know.
Content added Content deleted
m (trope=>work)
No edit summary
 
(27 intermediate revisions by 8 users not shown)
Line 1:
{{worktrope}}
[[I Thought It Meant|Just to clarify]]:
 
Line 5:
* A [[MacGuffin]] does not refer to [[Oop North|Scottish]] Muffins. Even if recipes for such things do indeed exist.
* [[Macho Camp]] is not a camp where the macho guys are residing. Although a [[Macho Camp]] would probably like to visit such a camp.
* [[Madden Into Misanthropy|Madden Into Madness]] does not involve [[Cool and Unusual Punishment|torture with clips of]] with [[Noodle Implements|clips of John Madden]], using him to narrate a descent into madness, an ill conceived game with him as a psychatrist, nor John Madden going [[Axe Crazy]].
** Nor even a person becoming crazy from playing too much of his games. [[Take That|That would be the executives that greenlighted]] ''[[Madden Nation]]''.
* [[Made of Iron]] is not [[Artificial Human|someone constructed]] of the 26th element of the periodic table. It does not refer to [[Iron Man|Tony Stark's]] armor, either.
Line 18:
* [[The Magic Goes Away]] is not about Magic Johnson quitting pro basketball to become a business head.
* [[Magic Misfire]] is not about the way Greedo missed Han firing at point-blank range in the Special Edition of ''[[Star Wars]]''.
* [[Magic Pants]] has nothing to do with [[Labyrinth (Film)|Jareth]]'s tights, nor [[Xenosaga (Video Game)|chaos']].
* [[The Magic Poker Equation]] is not a biography on David Williams.
* [[Magic Skirt]] is not a skirt with magical abilities.
Line 29:
* A [[Man-Eating Plant]] is a plant that eats men, not a man eating a plant. (It also isn't a factory that eats men, nor one that produces man-eaters.)
* [[Mangst]] is not angst about [[Manga]].
* [[Marathon Boss]] and the [[Marathon Level]] are not trademark features of ''[[Marathon (Video Game)Trilogy|Marathon]]''.
* [[The Mario]] does not involve [[Super Mario Bros Super Show|swinging your arms from side to side]].
* [[Marshmallow Hell]] is not where bad Peeps go when they die. Nor is it greedy people being [[Ironic Hell|force fed marshmallows]].
Line 35:
** Nor is it a [[Sugar Bowl]] so extreme it comes off as creepy.
** Nor has it to do with the giant, demonic Marshmallow Man from ''[[Ghostbusters]]''.
** Nor is it about the premise of that one [[The Simpsons (animation)|Simpsons]] episode where Homer is sent to Hell.
* [[Mary Tzu]] is not about a [[Mary Sue]] whose only defining characteristic is that she's Asian.
** Nor is it some special genetic engineering project to create the first ever [[Half-Human Hybrid|dog-human hybrid]].
* A [[Masquerade Ball]] is not what you [[Idiot Ball|give]] [[Distress Ball|to]] [[Villain Ball|a]] [[Conflict Ball|character]] when you need them to uphold [[The Masquerade]], when they usually don't.
* A [[Massive Multiplayer Scam]] is not a type of [[Allegedly Free Game]].
* You can't access the [[Master Console]] using the [[Sega Master System]].
* A [[Master of the Mixed Message]] does not do remixes.
** Nor is it someone who is [[Dave Barry|really good at anagrams]]
* [[Master Race]] is not about [[PC vs. Console|PC gamers becoming masters of their own gaming experience]].
* [[Matchlight Danger Revelation]] is not a warning about a gas leak.
** It ''is'', however, the [[Super Punk Octo Pudding Gas Mark Seven|title]] of the new anime series I just started creating just now!
Line 47 ⟶ 49:
* [[Matzo Fever]] is not about an obsession with Jewish crackers.
* [[The Maze]] will leave you confused because it changes direction a lot, [[Maze Megaburst Space|not its gender]].
* [[May Contain Evil]] is not about devices that may be used to produce a [[Sealed Evil in Aa Can]] effect.
* [[McLeaned]] does not refer to being turned into [[Total Drama Island (Animation)|Chris McLean]].
** Or losing weight through [[Super Size Me|eating at McDonald's]].
** Or Don McLean (although American Pie also involves death in a plane crash).
Line 57 ⟶ 59:
** Of course. [[Villains Never Lie|Why would we lie to you]]?
* [[Meat-O-Vision]] is not how burger ads are filmed.
** Nor is it a new set of goggles made to find cattle.
*** That would explain why [[The Goggles Do Nothing|they do nothing]].
* [[Meddling Parents]] don't need to [[You Meddling Kids|get away with it]], [[Can't Get Away Withwith Nuthin'|and they certainly won't let you, either]].
* [[Medium Awareness]] is not smaller than Large Awareness.
* [[Meet the New Boss]] is not a ''[[Team Fortress 2 (Video Game)|Team Fortress 2]]'' parody.
** Nor is it a type of scene you'd expect to find in a [[Work Com]].
** And it isn't about someone being the musical successor to Bruce Springsteen.
* [[Mega Manning]] isn't what you get when you use a [[Attack of the 50 -Foot Whatever|growth ray]] on Peyton or Eli. Or on [[Alpha Teens On Machines (Animation)|Axel]]. Or, well, a man. No Katies, either.
** It is also not about [[Mega Man (Videovideo Gamegame)|Mega Man]], [[Mega Man X (Video Game)|Mega Man X]], [[Mega Man Legends (Video Game)|Mega Man Volnutt-Trigger]], [[Mega Man Battle Network (Video Game)|MegaMan.EXE]] or [[Mega Man Star Force (Video Game)|Mega Man Geo-Omega]] [[Attack of the 50 -Foot Whatever|growing to a giant size]], though it has to do with them.
** Not is about becoming extremely manly.
*** Yes, [[Testosterone Poisoning|Wewe]] [[Rated "M" for Manly|have]] [[Took a Level Inin Badass|tropes]] [[Memetic Badass|enough]] as it is.
* [[Meganekko]] is not about huge cats. That would be [[Mega Neko]], which is, in turn, not about pretty girls who just wouldn't be the same without their glasses. (And neither of those has anything to do with the character "Big Pussy" from ''[[The Sopranos]]''.)
* [[Memento MacGuffin]] is not when it turns out you already got the [[MacGuffin]], but [[Memento (Film)|forgot about it]].
* A [[Memetic Badass]] is not someone who gains power from memes.
** Though that ''is'' an interesting idea for a super hero.
Line 78 ⟶ 80:
* A [[Memetic Outfit]] is not made of memes.
* [[Memetic Sex God]] does not involve deities being remembered only for the sex related parts of their domains.
* [[Men Can't Keep House]] has nothing to with the opposition of [[Yaoi]] involving ''[[House (TV series)|House]]''.
* [[The Men First]] has nothing to do with mysogony, nor the [[Sorting Algorithm Of Death]].
* [[Mercurial Base]] has nothing to do with fickle fans.
** It's also not what spills out of a [[Broken Base]]. (You're thinking "thermometer".)
* [[Mercy Kill]] is not the ritualised removal of merciful second-thoughts that a character undergoes before going on a [[Roaring Rampage of Revenge]].
* [[Me's a Crowd]] has nothing to do with [[Star Wars|Jar Jar Binks's]] [[Mooks]], or those encountered in [[Half Life|Black Mesa]], or the genetic ubermensch planet in the [[Honor Harrington (Literature)|Honor Harrington]] books.
* [[The Messiah]] is not a [[Messianic Archetype]] or even [[The Chosen One]]. As the page says, "we need to choose these names better."
* A [[Meta Fic]] is not a fanfiction about [[Kirby|Meta Knight]], who is also not an example of [[Meta Guy]].
Line 92 ⟶ 94:
* A [[Meteor Move]] is not an attack in which you [[Colony Drop|move a meteor]].
* [[Metroidvania]] is not a crossover between [[Castlevania]] and [[Metroid]], even though that ''should happen''.
* [[Metro Specific Underworld]] has little if anything to do with [[The World Ends With You (Video Game)|Shibuya's UG]]. It is also not where old Geos go to die. Nor is it a land of the dead [[Afterlife Express|only accessible by public transportation]]. Nor is it where [[Transformers|Metroplex]] will go when he dies. Nor does it have anything to do with ''[[Magic Knight Rayearth]]'' character [[Theme Naming|Geo Metro]]. Nor is it about a hell focused on fashion trends. ''[[Neverwhere]]'' is right out.
* [[Mexico Called. They Want Texas Back.]] is not a [[Sub-Trope]] of [[X Called. They Want Their Y Back.]].
* [[Mickey Mousing]] is not about creating a [[Funny Animal]] who is an Everyman Hero.
* [[Mighty Whitey]] has nothing to do with [[Captain Underpants]] or Orbit Gum.
* [[Miko]] is not a [[Nuns Are Mikos|nun]]. Nor is it a [[Order of the Stick|paladin]]. Nor does it [[Transformers Prime|hang out with Bulkhead.]]
* [[Mildly Military]] is not about [[Dad's Army (TV)|Sergeant Wilson]].
* [[Miles Gloriosus]] is not a Good/[[Evil Counterpart]] to the [[Inglourious Basterds]].
* A [[Military Mashup Machine]] will not, well, mash up the military.
Line 103 ⟶ 105:
** Nor is it about racking up tons of points from a giant cow boss in a [[Shoot'Em Up]].
** Nor is it about, well, [[Captain Obvious|milking a giant cow]].
* [[Milkman Conspiracy]]: If you've read [[Playing Withwith a Trope]], you might think it contains something like "The milkmen are really a front for an ancient conspiracy dedicated to impregnating the world's housewives."
* [[Mind Rape]] is not when a [[Mind Screw]] is forced upon you.
** Nor is it sexual intercourse with a brain.
* [[Mind Screw]] is not [[Mind Rape]], on the same note. Nor is it about an oddly shaped brain, or a tool for removing brains.
** Nor is it a more polite way of referring to a character from ''[[Empowered (Comic Book)|Empowered]]''.
* [[Minion Shipping]] is about two minions, not shipping a minion with his/her master. It's also not when a villain reacts to a minion [[You Have Failed Me...|failing him]] by putting the minion in a crate and shipping him far away.
* [[Misaimed Fandom]] is not about people trying to be fans of one series and ending up becoming fans of another. (How do you even ''do'' that?)
** Oh, ve haf our vays.
* [[Miscarriage of Justice]] is not about a female [[Complete Monster]] [[Convenient Miscarriage|losing her baby]].
** Nor is it a miscarriage caused by [[Super Smash Bros.|Captain Falcon's]] [[Memetic Mutation|knee.]]
* [[Misplaced Nationalism]] is not to be confused with [[Mistaken Nationality]], even though the latter does sometimes trigger the former.
* [[Misplaced Wildlife]] is not about animals "liberated" by [[Animal Wrongs Group|PETA]] and released in the wrong habitat afterwards.
* [["Mission Impossible" Cable Drop]] is not about dropping an USB cable on the floor, despite it not seeming possible.
* [[Miss Kitty]] is not the page for the actress who plays Trixie from ''[[American Dragon: Jake Long]]'' and Taranee from ''[[WITCH (Animationanimation)|WITCH]]'', nor for the [[One-Scene Wonder]] from ''[[The Great Mouse Detective]]''.
* [[Mister Cleaver]] is apparently not an [[Axe Crazy]] psychopath who cuts people up with a meat cleaver.
* [[Mister Seahorse]] is not the name for anyone in [[The Little Mermaid]], [[Finding Nemo]] or [[SpongebobSpongeBob SquarePants]].
* [[Misty May]] is not about [[Pokémon|Ash's female sidekicks]]. Nor a particularly foggy month in spring.
* [[Mnogo Nukes]] has nothing to do with [[Flash Gordon (Comiccomic Stripstrip)|Flash Gordon]]. Unless a "Typhoon" class submarine turns up.
* The [[Moebius Neighborhood]] is not the surroundings of the house belonging to the Oracle of Nosgoth. Nor is it where [[Sonic the Hedgehog (Franchise)|Sonic the Hedgehog]] used to live. Nor is it a town that [[World Shapes|keeps looping back on itself]].
** Nor is it about a neighborhood in [[Fresh Pretty Cure|Labyrinth]].
* [[Mock Cousteau]] is not our suggestion that you make fun of Jacques Cousteau, as he was actually really cool.
* [[Mode Lock]] does not describe mode-toggle buttons such as caps lock, scroll lock, etc. It also has nothing to do with [[wikipedia:Mode-locking|lasers]].
* [[Modesty Shorts]] are not short stories or cartoon shorts featuring [[Modesty Blaise (Franchise)|Modesty Blaise]].
* [[Moe Couplet]] does not necessarily involve very cute poetry. Although there's no rule saying that it ''doesn't''.
** Neither it norNor [[MoeRhymes Moe]]on refera toDime|two alines [[Crackof Pairingverse]] involvinguttered Moeby from ''[[The Simpsons (Animation)|The Simpsons]]'',a [[The Three Stooges|a Stooge]], or both.
** Neither it nor [[Moe Moe]] isrefer notto abouta [[Crack Pairing]] involving Moe from ''[[The Simpsons (Animationanimation)|The Simpsons]]'', character.a [[Brain Bleach|Oh dear GodStooge, no!]]or both.
* [[Moe]] is not about ''[[The Simpsons (animation)|The Simpsons]]'' character. [[Brain Bleach|Oh dear God, no!]]
* [[Moe Moe]] is not about a [[Avatar: The Last Airbender|flying lemur]].
** Nor is it a mispelled command to hastily cut grass.
* [[Mohs Scale of Rock and Metal Hardness]] does not refer to mineral substances. That's the original scale.
* [[The Mole]] is not related to [[Mole Men]].
* A [[Moment Killer]] is not an object that stops another object from [[wikipedia:Moment chr(28)physicschr(29physics)|rotating]]. Nor is it someone determined to [[Time Stands Still|stop time]].
* [[Monopoly]] isn't about companies that are the exclusive producer of a particular commodity.
* The [[Mons]] can be shown on TV without censorship.
** It's also not an acronym for [[Pokémon]], either.
* A [[Monster Protection Racket]] doesn't involve trying to pull a [[Shame If Something Happened|protection racket]] [[Mugging the Monster|on a monster]].
* A [[Monumental Battle]] is, sadly, not when [[Rule of Cool|two statues come to life and start fighting each other.]] [[DextersDexter's Laboratory|Whether or not two Preteen Geniuses are involved.]]
* "[[Mooks]]" is not the nickname for followers of the webcomic artist/writer behind ''[[Dominic Deegan]]: Oracle for Hire''.
** Nor does it have anything to do with the co-hosts of ''[[The Stephanie Miller Show (Radio)|The Stephanie Miller Show]]''.
** Or [[Transformers Animated|Dirt Boss]]
* [[The Moorcock Effect]] is not the [[Spear Counterpart]] of the [[Scunthorpe Problem]].
* [[Moral Event Horizon]] is not about [[An Aesop|any aesops]] in the film ''[[Event Horizon]]''.
* [[Moral Guardians]] are not a [[Superhero]] team where all the members are [[The Cape (trope)]].
* [[The Moral Substitute]] is not a substitute teacher with high moral standards.
* [[More Criminals Than Targets]] doesn't necessarily mean they've run out of department stores to rob.
* [[Morph Weapon]] is not what the [[Power Rangers]] beat you up with.
** Well, the first season ''did'' have those pistols that turned into swords...
* The [[Most Common Card Game]] is not ''[[Magic: theThe Gathering]]''...or [[Yu-Gi-Oh!|Duel Monsters]]... Or ''[[Duel Masters]]''... or ''[[Baten Kaitos]]''.
** It's not a card game about large breasts either.
** Or Poker, Bridge, Hearts, Spades, Rummy, Cribbage, Pinochle, Skat, Canasta, Klondike, Freecell, or Crazy Eights.
Line 159 ⟶ 163:
** It is not a bird's facial feathers.
* [[Mr. Smith]] did not necessarily go to [[Mr. Smith Goes to Washington|Washington]].
* [[Mr. Starship]] doesn't refer to Mickey Thomas, the [[Face of the Band|lead singer and face]] of [[Jefferson Airplane|Starship]].
* A [[All The Tropes:Multi-Part Picture|Multi-Part Picture]] is not [[Movie Multipack|a film serial]].
* A [[Multiple Head Case]] is not where the [[Serial Killer]] keeps his trophies.
* That [[Mummy]] is not [[Your Mom|yours]].
* [[Mundanger]] is not the name of a new [[Super Sentai]] series starring boring people.
* [[Murder the Hypotenuse]] is not what a mathematically-incapable [[Book Dumb]] character wants to do before moving on to the rest of the subject.
** Nor is it what [[The World Ends With You (Video Game)|Minamimoto]] does after killing all the "radians".
* [[Musical Gag]] is not how the "serious" film viewer reacts as soon as the first notes of the opening number play.
* A [[Musical Spoiler]] is not telling your friend who hasn't seen ''[[Wicked (Theatretheatre)|Wicked]]'' that Elphaba lives.
* [[Music Video Credits Sequence]] is not a credits sequence of a music video, but a film credits sequence which is done in a form of a music video.
* [[Must Seek Leek]] ''could'' be about watching ''[[William Shakespeare|Henry V]]'' for the "eat my leek" line, but that's not what it's named for. Nor is it about [[Pokémon|Farfetch'd]] desperately searching for a weapon.
* Although [[Multi Platform]] is a [[Video Game Tropes|video game trope]], it has nothing to do with the [[Platformer]] genre of video games.
* [[My Beloved Smother]] is not about being a [[Stalker Withwith a Crush]] to [[The Smothers Brothers Comedy Hour|Dick and Tommy Smothers]].
* [[My Girl Is Not a Slut]] is not an author's attempt to make a female character less [[Stripperiffic]].
* [[My Hero Zero]] is not a trope about [[Fan of Underdog|someone who perceives a feeble, klutzy zero to be a steeled, gutsy hero]]. Nor is it about [[The Hero]] losing badly at sports. And although somewhat related, it is not about being rescued from certain death at the hands of [[Mega Man X (Video Game)|Vile]], [[Code Geass|the Britannian Empire]] or [[Pilot Candidate|Zero Enna]] either.
** While we're on the subject, it has nothing to do with ''[[School HouseSchoolhouse Rock]]'' or prequels to ''[[My Hero (TV)]]'', either.
* [[My Kung Fu Is Stronger Than Yours]] is not a declaration of a type of martial art being inherently and objectively superior in combat to another.
* [[My Little Panzer]] is not the [[Rated "M" for Manly]] version of [[My Little Pony]].
* [[My Name Is Inigo Montoya]] is not about changing your name to [[The Princess Bride (Filmfilm)|Inigo Montoya]].
* [[My Own Grampa]] is not about someone really proud of his or her grandfather, and it's not related to the [[Grandfather Clause]].
* [[My Own Private I Do]] is not about gay marriage in fiction, much less with one or both <s>underground like a wild potato</s> closeted.
** It does not refer to marrying one's own genitals.
** And definitely not sex with the soldiers under your command.
* [[My Rules Are Not Your Rules]] is not about moral relativism.
** It is not a refusal to share your measuring devices.
* [[My Sensors Indicate You Want to Tap That]] has nothing to do with robots playing [[Magic the Gathering|Magic: The Gathering]].
* [[My Skull Runneth Over]] is not about the improvised goblet used by the [[I'm a Humanitarian|humanitarian]] who likes [[A Glass of Chianti]] after dinner.
* [[Myth Arc]] has nothing to do with Robert Asprin's ''Myth'' series.
* [[Mythology Gag]] is not the result of reading about the [[Mythology|birth]] of Odin's horse.
** Nor is it when you make a joke about mythology, though in an adaptation of a myth, a joke about the original might be a [[Mythology Gag]].
 
 
== N ==
* [[Naming Conventions]] is not about deciding what to call your fan get-togethers.
* [[Nanomachines]] are not typical implements used by [[Magical Girl Lyrical Nanoha|Nanoha]]. Those would be [[Magic Wand|Magic Wands]]s and [[Attack Drone|Attack Drones]]s.
* [[Napier]] has nothing to do with the actor who plays [[Power Rangers Dino Thunder|Conner McKnight]]
** It also has nothing to do with Jack Napier, alias [[The Joker]].
* [[Narm]] is not something [[Pinky and The Brain|Pinky]] says. Nor is [[Nerf]] or [[Zork (Video Game)|Zork]].
* [[National Stereotypes]] aren't models of audio equipment made in a country, no matter what [[Cyanide & Happiness|Rob]] [http://explosm.net/comics/2862/ thinks]. Particularly not [[wikipedia:National (brand)|Panasonic]].
* [[Near Villain Victory]] is a [[Eucatastrophe|miracle for the heroes]], not a spoiler for the end of ''[[Death Note (Manga)|Death Note]]''. {{spoiler|Even if it's arguably correct.}}
** [[Near-Death Experience]] is not {{spoiler|The 40 seconds Near waited to see Light and Mikami fail in killing them.}}
** As for [[Near-Rape Experience]], we're not going to [[Squick|go on that subject]].
* A [[Neck Lift]] will not make you look 10 years younger.
* [[Necessary Weasel]] has nothing to do with [[Weasel Words]].
* [[The Needless]] isn't a character or element the work could do without.
* [[Needs More Love]] isn't about the poor [[Woobie|Woobies]]s and similar characters.
* A [[NEET]] is not a [[Keet]] who has [[Super OCD]].
* [[Nerf]] has nothing to do with the creatures from ''[[Star Wars]]'' known for their scruffy herders.
* The [[Nerf Arm]] is not a foam limb, it's not necessarily made by NERF, and isn't the arm with which game designers depower otherwise [[Game Breaker]] functionality.
* [[Never Recycle a Building]] is not advice to game developers to avoid overdoing [[Copy and Paste Environments]].
* [[Never Say "Die"]] does not refer to never using the singular form of "dice."
* [[Never Trust a Trailer]] has nothing to do with personal suspicion of those things that trucks drag behind them. Where ''does'' [[Transformers|Optimus]]' go?
** [[Memetic Badass|Wherever the hell it wants!]]
Line 212 ⟶ 220:
* [[News Monopoly]] is not about how, when characters watch [[24-Hour News Networks]], if it's a Fox show it'll be Fox News, and if it's an NBC show it'll be MSNBC.
** It's also not among the [[Recycled Premise|hundreds of versions]] of [[Monopoly]].
* [[Newspaper Dating]] has nothing to do with personal ads in the classifieds. It also doesn't mean that sentient newspapers are dating, either, although [[Rule 34]] says [[Squick|someone has written an explicit version of that]].
** It also doesn't mean that sentient newspapers are dating, either, although [[Rule 34]] says [[Squick|someone has written an explicit version of that]].
* [[Nice Job Breaking It, Hero]] is not an expression of appreciation when admiring the pyrokinetics after the [[Supervillain Lair]] and/or the [[Death Ray]] have been blown up by [[The Hero]].
* A [[Nietzsche Wannabe]] is not some random forum poster who thinks s/he's so damn clever for abusing Nietzsche's famous "he who hunts monsters" quote against someone s/he doesn't like.
Line 218 ⟶ 227:
** The "Nightmare Fuel" trope itself has had numerous problems in the past, because it wasn't obvious by its name that it meant ''unintentional'' nightmare fuel. This potential for confusion got so bad that eventually the page was transplanted to [[Accidental Nightmare Fuel]] and a more general "scary things" trope plugged into its place.
* [[Nightmare Fuel Coloring Book]] is not the example page for [[Nightmare Fuel]] from coloring books.
* [[Nightmare Fuel Station Attendant]] has nothing to do with [[Tales Fromfrom the Crypt|the Cryptkeeper]] or Elvira, Mistress of the Dark, having to get a new job.
* A [[Nightmare Sequence]] is not part of the gameplay of a [[Nintendo Hard]] game which motivates [[Sequence Breaking]].
* ''[[The 99 (Comic Book)|The 99]]'' has nothing to do with [http://www.99restaurants.com/ the restaurant],[[Ninety -Nine Nights|Nights]], or [[Jay Z|the problems of which a woman is not included among]].
* [[Ninja Butterfly|Ninja Butterflies]] are, sadly, not... well... butterflies who are [[Ninja|Ninjas]]s. Nor ninjas who use butterflies as shurikens.
* A [[Ninja Log]] is not the logbook of a [[Ninja Pirate Zombie Robot]] Captain's journeys.
* [[Ninja Pirate Zombie Robot]] is not a [[Follow the Leader|knock off]] of ''[[Teenage Mutant Ninja Turtles]]''.
Line 227 ⟶ 236:
** It also has very little in common with a [[Stealth Run]].
* [[Ninja Tropes]] are not appreciably stealthier or deadlier than any other tropes.
* [[Nintendo Hard]] is not about getting a hard-on while playing Nintendo games.
* [[wikipedia:Nipah virus#Nipah virus|Nipah Virus]] will not cause you to become a cute child forced to [[Groundhog Day Loop|relive the same]] [[The Eighties|1980s summers]] [[Alternate Universe|over and over again]].
* [[Nippon Ichi]] is not about [[Fatal Fury|Mai Shiranui]] or her [[Gainaxing|most valuable pair]]. Or Japan being itchy.
** It's not "Me Bouncy!", by the way.
* [[Nobody Can Die]] is not an alternate name for [[Death Takes a Holiday]] (the former describes settings wherein people ''should'' die, they just never seem to, while the latter describes situations in which nobody can die for good, in-universe reasons.)
* [[No BraCan Opener]] doesisn't nota meansituation notwhere wearingthe underwear.villain Thatis wouldhaving betrouble unleashing a [[VaporSealed Evil in a WearCan]].
* [[No Can Opener]] isn't a situation where the villain is having trouble unleashing a [[Sealed Evil in A Can]].
* [[No Casualties Run]] is not the next line from the mouth of the guy who declared that [[No One Could Survive That]].
* [[No Conservation of Energy]] is not about someone who makes no attempt to reduce his or her power bill.
* [[No Conservation of Mass]] is not a subversion of [[Christianity is Catholic]].
* [[No Cure for Evil]] is not a proclamation that evil people are beyond redemption. Neither does it have to do with [[As Long Asas There Is Evil]].
** It's also not about a rule that states that the bad guys of ''[[Pretty Cure]]'' series can't have a Cure of their own. ([[Heartcatch Pretty Cure|They had]], [[Darker and Edgier|and HOW!]])
* [[No Ending]] is not when a fictional work ends with a [[Big No]].
Line 242 ⟶ 251:
* [[No Final Boss for You]] is not about games that [[Bad Export for You|don't have final bosses when released in other parts of the world]].
* [[No Flow in CGI]] is not about CGI characters who can't have their periods.
* [[No Guy Wants an Amazon]] isn't about the failure of the Fire Phone to sell.
* [[No Guy Wants to Be Chased]] is not about guys hating being the one being chased in a car chase, nor is it about [[I Wanna Be the Guy|The Guy]] not liking those [[Advancing Wall of Doom]] segments.
* [[No Honor Among Thieves]] is not [[David Weber]] saying that there will be no ''[[Honor Harrington (Literature)|Honor Harrington]]'' books called ''[[Honor Among Thieves]]''.
* [[Noisy Guns]] are not firearms that are running around hooting and hollering.
** Nor are they guns that are unrealistically noisy when ''shot''; that's [[Bang Bang BANG]].
* [["No. Just... No" Reaction]] is not how [[Dr. No (Film)|Dr. No]] [[The Name Is Bond, James Bond|introduces]] himself.
* [[Nom De Mom]] doesn't mean that a character's alias or [[Unnamed Parent|only name]] is Mom. Nor does it refer to [[Monster Misogyny|moms getting eaten]].
* [[Nominal Hero]] is not a list of [[Character Title|works named after their protagonists]].
* [[No Mouth]] [[And I Must Scream]] seem to be one trope, but they're not.
* [[Noodle Incident]] has nothing to do with the guitarist of [[Gorillaz]]. (Necessarily.)
* [[Noodle Implements]] is not about tools made out of pasta. Believe me, I tried, don't ask.
* [[No OSHA Compliance]] is not about policies that forbid [[Street Fighter Alpha (Video Game)|Dan from taunting]].
** Nor does it refer to [[Game of Thrones|Osha refusing to submit to Theon Greyjoy]].
* [[No Party Given]] is not about a disappointing birthday.
* [[No Periods, Period]] most certainly has nothing to do with punctuation.
* [[No Recycling]] is not an aversion of [[Copy and Paste Environments]].
* [[No SellSaving Throw]] is not about when a sales clerk hasplace to opencomplain upabout aauthors cashwho registerdidn't justdo toan make[[Author's smallSaving changeThrow]].
* No Sell (now known as [[Won't Work On Me]]) is not about when a sales clerk has to open up a cash register just to make small change.
* [[No Sex Allowed]] is not a proclamation that a certain person will never, ever get laid.
* [[Nostalgia Filter]] is not a search engine exclusive to [[That Guy With theThe Glasses]].com.
* [[No Such Thing Asas Space Jesus]] is not about [[Space Jews]].
* [[Not Cheating Unless You Get Caught]] has nothing to do with cheating on your significant other.
* [[Not Completely Useless]] is not about backhanded compliments given to [[The Load]] after a [[Crowning Moment of Awesome]].
* [[Not Enough to Bury]] does not mean "it's not enough to bury this person's remains; [[There Is No Kill Like Overkill|let's grind their corpse in a shredder]]".
* [[Nothing but Hits]] apparently doesn't refer to a soundtrack comprising entirely of orchestral hits.
** Nor does it refer to someone with [[Improbable Aiming Skills|really good aim]].
** Nor is it about the [[Always Accurate Attack]].
* [[Nothing Is Scarier]] is not about the ultimate scare.
* [[Nothing Left to Thethe Imagination]] is not a description of the outfit [[Ms. Fanservice]] is wearing.
* [[The Not Love Interest]] isn't the person that's [[She Is Not My Girlfriend|accused of being your boyfriend/girlfriend all the time]].
* [[Not Now, Kiddo]] is not related to [[Kill Bill]] or [[Soul Eater|Death the Kid]].
* [[Not Using the Zed Word]] does not involve refusal to talk about a certain ''[[Power Rangers]]'' villain or ignoring the boss of the ''[[Men in Black (Filmfilm)|Men in Black]]''.
* [[Not Quite Daily Comic]] isn't about [[Schedule Slip|Schedule Slips]] of [[Web Comics]].
* A [["Not Wearing Pants" Dream]] isn't a longing to make [[Man in a Kilt|the kilt]] more accepted.
* [[Not Using the Zed Word]] does not involve refusal to talk about a certain ''[[Power Rangers]]'' villain or ignoring the boss of the ''[[Men in Black (Film)|Men in Black]]''.
** [["NotNor Wearingdoes Pants"it Dream]]have has nothinganything to do with ''[[Strike Witches]]''.
* [[Not Wearing Tights]] is not about a male character or tomboyish female refusing to wear "girly" clothes.
* [[No U]] is not a [[Constrained Writing|lipogram]] lacking the letter after T.
* [[No Yay]] is not a moment in sports where the crowd boos.
* [[No, You]] does not exclude the target.
* A [[Nuclear Family]] has nothing to do with nuclear power. Well, except for ''[[The Simpsons]]''. And ''[[PS238]]''.
* A [[Nuclear Option]] is not what Utsuho Reiuji's power-up would be if she became playable in the next ''[[Touhou]]'' game.
* [[Number Two]] is not related to [[Potty Emergency]] or [[Bring My Brown Pants]]. Or, for that matter, [[Oh Crap]].
* [[Nu Metal-metal]] is not what ''[[Blaz BlueBlazBlue]]'s'' [[Robot Girl]] is built with.
 
{{reflist}}
{{I Thought It Meant}}
[[Category:I Thought It Meant]]
[[Category:M-NSplit Trope Lists]]

Latest revision as of 15:22, 3 May 2024


Just to clarify:

M

N